C25H21FN2O3 — CID 59475037
(E)-3-(4-fluorophenyl)-N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl]-2-phenylprop-2-enamide (PubChem CID 59475037) has the molecular formula C25H21FN2O3 and a molecular weight of 416.45 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl]-2-phenylprop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl]-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 59475037 |
| Molecular Formula | C25H21FN2O3 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl]-2-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(CNC(=O)/C(=C/c2ccc(F)cc2)c2ccccc2)cc1)NO |
| InChI | InChI=1S/C25H21FN2O3/c26-22-13-10-19(11-14-22)16-23(21-4-2-1-3-5-21)25(30)27-17-20-8-6-18(7-9-20)12-15-24(29)28-31/h1-16,31H,17H2,(H,27,30)(H,28,29)/b15-12+,23-16+ |
| InChIKey | BXQPXWOBNHWIMW-GXSAIBHDSA-N |
| XLogP | 4.20 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|