C17H14F2N2O3 — CID 71461034
(2Z)-N-[(4-fluorophenyl)methyl]-2-[(4-fluorophenyl)methylidene]-N'-hydroxypropanediamide (PubChem CID 71461034) has the molecular formula C17H14F2N2O3 and a molecular weight of 332.31 g/mol. Its IUPAC name is (2Z)-N-[(4-fluorophenyl)methyl]-2-[(4-fluorophenyl)methylidene]-N'-hydroxypropanediamide.
| Compound Name | (2Z)-N-[(4-fluorophenyl)methyl]-2-[(4-fluorophenyl)methylidene]-N'-hydroxypropanediamide |
|---|---|
| PubChem CID | 71461034 |
| Molecular Formula | C17H14F2N2O3 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (2Z)-N-[(4-fluorophenyl)methyl]-2-[(4-fluorophenyl)methylidene]-N'-hydroxypropanediamide |
| SMILES | O=C(NO)/C(=C\c1ccc(F)cc1)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H14F2N2O3/c18-13-5-1-11(2-6-13)9-15(17(23)21-24)16(22)20-10-12-3-7-14(19)8-4-12/h1-9,24H,10H2,(H,20,22)(H,21,23)/b15-9- |
| InChIKey | AFTNYQQEGYCLRW-DHDCSXOGSA-N |
| XLogP | 2.17 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|