C18H16FNO3 — CID 68878501
2-[(4-fluorophenyl)methylcarbamoyl]-4-phenylbut-2-enoic acid (PubChem CID 68878501) has the molecular formula C18H16FNO3 and a molecular weight of 313.33 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylcarbamoyl]-4-phenylbut-2-enoic acid.
| Compound Name | 2-[(4-fluorophenyl)methylcarbamoyl]-4-phenylbut-2-enoic acid |
|---|---|
| PubChem CID | 68878501 |
| Molecular Formula | C18H16FNO3 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-[(4-fluorophenyl)methylcarbamoyl]-4-phenylbut-2-enoic acid |
| SMILES | O=C(O)C(=CCc1ccccc1)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FNO3/c19-15-9-6-14(7-10-15)12-20-17(21)16(18(22)23)11-8-13-4-2-1-3-5-13/h1-7,9-11H,8,12H2,(H,20,21)(H,22,23) |
| InChIKey | IRBBAMPMTQWWKN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|