C27H25FN2O5 — CID 87472781
(Z)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl]prop-2-enamide (PubChem CID 87472781) has the molecular formula C27H25FN2O5 and a molecular weight of 476.50 g/mol. Its IUPAC name is (Z)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl]prop-2-enamide.
| Compound Name | (Z)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 87472781 |
| Molecular Formula | C27H25FN2O5 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | (Z)-3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)-N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C(\C(=O)NCc2ccc(/C=C/C(=O)NO)cc2)c2ccccc2F)cc1OC |
| InChI | InChI=1S/C27H25FN2O5/c1-34-24-13-11-20(16-25(24)35-2)15-22(21-5-3-4-6-23(21)28)27(32)29-17-19-9-7-18(8-10-19)12-14-26(31)30-33/h3-16,33H,17H2,1-2H3,(H,29,32)(H,30,31)/b14-12+,22-15- |
| InChIKey | NWUWUVAZIAPRNC-NSLMBMCXSA-N |
| XLogP | 4.22 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|