C30H27FN2O4 — CID 68767568
methyl 4-[[3-[4-[(E)-3-(cyclopropylamino)-2-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]prop-2-enoylamino]methyl]benzoate (PubChem CID 68767568) has the molecular formula C30H27FN2O4 and a molecular weight of 498.55 g/mol. Its IUPAC name is methyl 4-[[3-[4-[(E)-3-(cyclopropylamino)-2-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]prop-2-enoylamino]methyl]benzoate.
| Compound Name | methyl 4-[[3-[4-[(E)-3-(cyclopropylamino)-2-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]prop-2-enoylamino]methyl]benzoate |
|---|---|
| PubChem CID | 68767568 |
| Molecular Formula | C30H27FN2O4 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | methyl 4-[[3-[4-[(E)-3-(cyclopropylamino)-2-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]prop-2-enoylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)C=Cc2ccc(/C=C(/C(=O)NC3CC3)c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H27FN2O4/c1-37-30(36)24-9-6-22(7-10-24)19-32-28(34)17-8-20-2-4-21(5-3-20)18-27(29(35)33-26-15-16-26)23-11-13-25(31)14-12-23/h2-14,17-18,26H,15-16,19H2,1H3,(H,32,34)(H,33,35)/b17-8?,27-18+ |
| InChIKey | LVLBGLJNIOHCCM-ASQQTUJNSA-N |
| XLogP | 4.76 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|