C21H18F2N2O3 — CID 25267666
(E)-N-cyclopropyl-2-(3,4-difluorophenyl)-3-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]prop-2-enamide (PubChem CID 25267666) has the molecular formula C21H18F2N2O3 and a molecular weight of 384.38 g/mol. Its IUPAC name is (E)-N-cyclopropyl-2-(3,4-difluorophenyl)-3-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-cyclopropyl-2-(3,4-difluorophenyl)-3-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 25267666 |
| Molecular Formula | C21H18F2N2O3 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (E)-N-cyclopropyl-2-(3,4-difluorophenyl)-3-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(/C=C(/C(=O)NC2CC2)c2ccc(F)c(F)c2)cc1)NO |
| InChI | InChI=1S/C21H18F2N2O3/c22-18-9-6-15(12-19(18)23)17(21(27)24-16-7-8-16)11-14-3-1-13(2-4-14)5-10-20(26)25-28/h1-6,9-12,16,28H,7-8H2,(H,24,27)(H,25,26)/b10-5+,17-11+ |
| InChIKey | OTLANCPCHDXHRP-CYBPPMFUSA-N |
| XLogP | 3.30 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|