C27H23F2N3O4 — CID 87568790
4-[[[4-[(Z)-3-(cyclopropylamino)-2-(3,4-difluorophenyl)-3-oxoprop-1-enyl]benzoyl]amino]methyl]-N-hydroxybenzamide (PubChem CID 87568790) has the molecular formula C27H23F2N3O4 and a molecular weight of 491.49 g/mol. Its IUPAC name is 4-[[[4-[(Z)-3-(cyclopropylamino)-2-(3,4-difluorophenyl)-3-oxoprop-1-enyl]benzoyl]amino]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[[4-[(Z)-3-(cyclopropylamino)-2-(3,4-difluorophenyl)-3-oxoprop-1-enyl]benzoyl]amino]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 87568790 |
| Molecular Formula | C27H23F2N3O4 |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 4-[[[4-[(Z)-3-(cyclopropylamino)-2-(3,4-difluorophenyl)-3-oxoprop-1-enyl]benzoyl]amino]methyl]-N-hydroxybenzamide |
| SMILES | O=C(NC1CC1)/C(=C\c1ccc(C(=O)NCc2ccc(C(=O)NO)cc2)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C27H23F2N3O4/c28-23-12-9-20(14-24(23)29)22(27(35)31-21-10-11-21)13-16-1-5-18(6-2-16)25(33)30-15-17-3-7-19(8-4-17)26(34)32-36/h1-9,12-14,21,36H,10-11,15H2,(H,30,33)(H,31,35)(H,32,34)/b22-13- |
| InChIKey | UQYXRIWWKPHCSS-XKZIYDEJSA-N |
| XLogP | 3.83 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|