C16H15FN2O3 — CID 167771405
2-fluoro-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-5-methylbenzamide (PubChem CID 167771405) has the molecular formula C16H15FN2O3 and a molecular weight of 302.31 g/mol. Its IUPAC name is 2-fluoro-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-5-methylbenzamide.
| Compound Name | 2-fluoro-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-5-methylbenzamide |
|---|---|
| PubChem CID | 167771405 |
| Molecular Formula | C16H15FN2O3 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-fluoro-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-5-methylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)NCc2ccc(C(=O)NO)cc2)c1 |
| InChI | InChI=1S/C16H15FN2O3/c1-10-2-7-14(17)13(8-10)16(21)18-9-11-3-5-12(6-4-11)15(20)19-22/h2-8,22H,9H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | CJUVRJRINFFYFM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|