C17H18FNO — CID 34485315
N-[(3-fluoro-4-methylphenyl)methyl]-2,4-dimethylbenzamide (PubChem CID 34485315) has the molecular formula C17H18FNO and a molecular weight of 271.34 g/mol. Its IUPAC name is N-[(3-fluoro-4-methylphenyl)methyl]-2,4-dimethylbenzamide.
| Compound Name | N-[(3-fluoro-4-methylphenyl)methyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 34485315 |
| Molecular Formula | C17H18FNO |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-[(3-fluoro-4-methylphenyl)methyl]-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCc2ccc(C)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C17H18FNO/c1-11-4-7-15(13(3)8-11)17(20)19-10-14-6-5-12(2)16(18)9-14/h4-9H,10H2,1-3H3,(H,19,20) |
| InChIKey | QDAPQAJBHLEELD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |