C27H24ClN3O3 — CID 70265458
4-[[[4-[(E)-2-(3-chlorophenyl)-3-(cyclopropylamino)-3-oxoprop-1-enyl]benzoyl]amino]methyl]benzamide (PubChem CID 70265458) has the molecular formula C27H24ClN3O3 and a molecular weight of 473.96 g/mol. Its IUPAC name is 4-[[[4-[(E)-2-(3-chlorophenyl)-3-(cyclopropylamino)-3-oxoprop-1-enyl]benzoyl]amino]methyl]benzamide.
| Compound Name | 4-[[[4-[(E)-2-(3-chlorophenyl)-3-(cyclopropylamino)-3-oxoprop-1-enyl]benzoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 70265458 |
| Molecular Formula | C27H24ClN3O3 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 4-[[[4-[(E)-2-(3-chlorophenyl)-3-(cyclopropylamino)-3-oxoprop-1-enyl]benzoyl]amino]methyl]benzamide |
| SMILES | NC(=O)c1ccc(CNC(=O)c2ccc(/C=C(/C(=O)NC3CC3)c3cccc(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C27H24ClN3O3/c28-22-3-1-2-21(15-22)24(27(34)31-23-12-13-23)14-17-4-10-20(11-5-17)26(33)30-16-18-6-8-19(9-7-18)25(29)32/h1-11,14-15,23H,12-13,16H2,(H2,29,32)(H,30,33)(H,31,34)/b24-14+ |
| InChIKey | OOEBGRIUTGUHIG-ZVHZXABRSA-N |
| XLogP | 4.19 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|