C27H24FN3O4 — CID 59575500
4-[[[4-[(E)-3-(cyclopropylamino)-2-(3-fluorophenyl)-3-oxoprop-1-enyl]benzoyl]amino]methyl]-N-hydroxybenzamide (PubChem CID 59575500) has the molecular formula C27H24FN3O4 and a molecular weight of 473.50 g/mol. Its IUPAC name is 4-[[[4-[(E)-3-(cyclopropylamino)-2-(3-fluorophenyl)-3-oxoprop-1-enyl]benzoyl]amino]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[[4-[(E)-3-(cyclopropylamino)-2-(3-fluorophenyl)-3-oxoprop-1-enyl]benzoyl]amino]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 59575500 |
| Molecular Formula | C27H24FN3O4 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 4-[[[4-[(E)-3-(cyclopropylamino)-2-(3-fluorophenyl)-3-oxoprop-1-enyl]benzoyl]amino]methyl]-N-hydroxybenzamide |
| SMILES | O=C(NC1CC1)/C(=C/c1ccc(C(=O)NCc2ccc(C(=O)NO)cc2)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C27H24FN3O4/c28-22-3-1-2-21(15-22)24(27(34)30-23-12-13-23)14-17-4-8-19(9-5-17)25(32)29-16-18-6-10-20(11-7-18)26(33)31-35/h1-11,14-15,23,35H,12-13,16H2,(H,29,32)(H,30,34)(H,31,33)/b24-14+ |
| InChIKey | HSISKFHOSWEWCB-ZVHZXABRSA-N |
| XLogP | 3.69 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|