C25H28FN3O4 — CID 59575513
4-[(E)-3-(cyclopropylamino)-2-(3-fluorophenyl)-3-oxoprop-1-enyl]-N-[6-(hydroxyamino)-6-oxohexyl]benzamide (PubChem CID 59575513) has the molecular formula C25H28FN3O4 and a molecular weight of 453.51 g/mol. Its IUPAC name is 4-[(E)-3-(cyclopropylamino)-2-(3-fluorophenyl)-3-oxoprop-1-enyl]-N-[6-(hydroxyamino)-6-oxohexyl]benzamide.
| Compound Name | 4-[(E)-3-(cyclopropylamino)-2-(3-fluorophenyl)-3-oxoprop-1-enyl]-N-[6-(hydroxyamino)-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 59575513 |
| Molecular Formula | C25H28FN3O4 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 4-[(E)-3-(cyclopropylamino)-2-(3-fluorophenyl)-3-oxoprop-1-enyl]-N-[6-(hydroxyamino)-6-oxohexyl]benzamide |
| SMILES | O=C(CCCCCNC(=O)c1ccc(/C=C(/C(=O)NC2CC2)c2cccc(F)c2)cc1)NO |
| InChI | InChI=1S/C25H28FN3O4/c26-20-6-4-5-19(16-20)22(25(32)28-21-12-13-21)15-17-8-10-18(11-9-17)24(31)27-14-3-1-2-7-23(30)29-33/h4-6,8-11,15-16,21,33H,1-3,7,12-14H2,(H,27,31)(H,28,32)(H,29,30)/b22-15+ |
| InChIKey | FVBACTANTWVQGC-PXLXIMEGSA-N |
| XLogP | 3.44 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|