C23H26FN3O4S — CID 140553182
6-[[(Z)-2-(4-fluorophenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]carbamoylamino]-N-hydroxyhexanamide (PubChem CID 140553182) has the molecular formula C23H26FN3O4S and a molecular weight of 459.54 g/mol. Its IUPAC name is 6-[[(Z)-2-(4-fluorophenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]carbamoylamino]-N-hydroxyhexanamide.
| Compound Name | 6-[[(Z)-2-(4-fluorophenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]carbamoylamino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 140553182 |
| Molecular Formula | C23H26FN3O4S |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 6-[[(Z)-2-(4-fluorophenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]carbamoylamino]-N-hydroxyhexanamide |
| SMILES | CSc1ccc(/C=C(\C(=O)NC(=O)NCCCCCC(=O)NO)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H26FN3O4S/c1-32-19-12-6-16(7-13-19)15-20(17-8-10-18(24)11-9-17)22(29)26-23(30)25-14-4-2-3-5-21(28)27-31/h6-13,15,31H,2-5,14H2,1H3,(H,27,28)(H2,25,26,29,30)/b20-15- |
| InChIKey | KZZWUTWMZISFEC-HKWRFOASSA-N |
| XLogP | 3.98 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|