C22H25FN2O4S — CID 68536410
methyl 6-[[2-(4-fluorophenyl)-3-(4-methylthiophen-2-yl)prop-2-enoyl]carbamoylamino]hexanoate (PubChem CID 68536410) has the molecular formula C22H25FN2O4S and a molecular weight of 432.52 g/mol. Its IUPAC name is methyl 6-[[2-(4-fluorophenyl)-3-(4-methylthiophen-2-yl)prop-2-enoyl]carbamoylamino]hexanoate.
| Compound Name | methyl 6-[[2-(4-fluorophenyl)-3-(4-methylthiophen-2-yl)prop-2-enoyl]carbamoylamino]hexanoate |
|---|---|
| PubChem CID | 68536410 |
| Molecular Formula | C22H25FN2O4S |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | methyl 6-[[2-(4-fluorophenyl)-3-(4-methylthiophen-2-yl)prop-2-enoyl]carbamoylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)NC(=O)C(=Cc1cc(C)cs1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H25FN2O4S/c1-15-12-18(30-14-15)13-19(16-7-9-17(23)10-8-16)21(27)25-22(28)24-11-5-3-4-6-20(26)29-2/h7-10,12-14H,3-6,11H2,1-2H3,(H2,24,25,27,28) |
| InChIKey | SLMQUOBTGXJRDM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|