C19H20ClFN2O3S — CID 87243849
6-[[(E)-3-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)prop-2-enoyl]amino]-N-hydroxyhexanamide (PubChem CID 87243849) has the molecular formula C19H20ClFN2O3S and a molecular weight of 410.90 g/mol. Its IUPAC name is 6-[[(E)-3-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)prop-2-enoyl]amino]-N-hydroxyhexanamide.
| Compound Name | 6-[[(E)-3-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)prop-2-enoyl]amino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 87243849 |
| Molecular Formula | C19H20ClFN2O3S |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 6-[[(E)-3-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)prop-2-enoyl]amino]-N-hydroxyhexanamide |
| SMILES | O=C(CCCCCNC(=O)/C(=C/c1ccc(Cl)s1)c1ccc(F)cc1)NO |
| InChI | InChI=1S/C19H20ClFN2O3S/c20-17-10-9-15(27-17)12-16(13-5-7-14(21)8-6-13)19(25)22-11-3-1-2-4-18(24)23-26/h5-10,12,26H,1-4,11H2,(H,22,25)(H,23,24)/b16-12+ |
| InChIKey | HLKHVQHMAMPYQZ-FOWTUZBSSA-N |
| XLogP | 4.26 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|