C29H29FN2O3S — CID 88879251
6-[[2-(4-fluorophenyl)-3-(4-methanethioylphenyl)prop-2-enoyl]amino]-N-phenylmethoxyhexanamide (PubChem CID 88879251) has the molecular formula C29H29FN2O3S and a molecular weight of 504.63 g/mol. Its IUPAC name is 6-[[2-(4-fluorophenyl)-3-(4-methanethioylphenyl)prop-2-enoyl]amino]-N-phenylmethoxyhexanamide.
| Compound Name | 6-[[2-(4-fluorophenyl)-3-(4-methanethioylphenyl)prop-2-enoyl]amino]-N-phenylmethoxyhexanamide |
|---|---|
| PubChem CID | 88879251 |
| Molecular Formula | C29H29FN2O3S |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 6-[[2-(4-fluorophenyl)-3-(4-methanethioylphenyl)prop-2-enoyl]amino]-N-phenylmethoxyhexanamide |
| SMILES | O=C(CCCCCNC(=O)C(=Cc1ccc(C=S)cc1)c1ccc(F)cc1)NOCc1ccccc1 |
| InChI | InChI=1S/C29H29FN2O3S/c30-26-16-14-25(15-17-26)27(19-22-10-12-24(21-36)13-11-22)29(34)31-18-6-2-5-9-28(33)32-35-20-23-7-3-1-4-8-23/h1,3-4,7-8,10-17,19,21H,2,5-6,9,18,20H2,(H,31,34)(H,32,33) |
| InChIKey | JVEXDONWASTNSX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|