C29H31FN2O3S — CID 24963204
6-[[(Z)-2-(4-fluorophenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]-N-phenylmethoxyhexanamide (PubChem CID 24963204) has the molecular formula C29H31FN2O3S and a molecular weight of 506.64 g/mol. Its IUPAC name is 6-[[(Z)-2-(4-fluorophenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]-N-phenylmethoxyhexanamide.
| Compound Name | 6-[[(Z)-2-(4-fluorophenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]-N-phenylmethoxyhexanamide |
|---|---|
| PubChem CID | 24963204 |
| Molecular Formula | C29H31FN2O3S |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 6-[[(Z)-2-(4-fluorophenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]-N-phenylmethoxyhexanamide |
| SMILES | CSc1ccc(/C=C(\C(=O)NCCCCCC(=O)NOCc2ccccc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H31FN2O3S/c1-36-26-17-11-22(12-18-26)20-27(24-13-15-25(30)16-14-24)29(34)31-19-7-3-6-10-28(33)32-35-21-23-8-4-2-5-9-23/h2,4-5,8-9,11-18,20H,3,6-7,10,19,21H2,1H3,(H,31,34)(H,32,33)/b27-20- |
| InChIKey | QGHHLPXZLKETPT-OOAXWGSJSA-N |
| XLogP | 6.01 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|