C30H30FN3O2S2 — CID 74374693
6-[[2-(4-fluorophenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]-N-(5-methyl-1,3-benzothiazol-2-yl)hexanamide (PubChem CID 74374693) has the molecular formula C30H30FN3O2S2 and a molecular weight of 547.72 g/mol. Its IUPAC name is 6-[[2-(4-fluorophenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]-N-(5-methyl-1,3-benzothiazol-2-yl)hexanamide.
| Compound Name | 6-[[2-(4-fluorophenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]-N-(5-methyl-1,3-benzothiazol-2-yl)hexanamide |
|---|---|
| PubChem CID | 74374693 |
| Molecular Formula | C30H30FN3O2S2 |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 6-[[2-(4-fluorophenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]-N-(5-methyl-1,3-benzothiazol-2-yl)hexanamide |
| SMILES | CSc1ccc(C=C(C(=O)NCCCCCC(=O)Nc2nc3cc(C)ccc3s2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C30H30FN3O2S2/c1-20-7-16-27-26(18-20)33-30(38-27)34-28(35)6-4-3-5-17-32-29(36)25(22-10-12-23(31)13-11-22)19-21-8-14-24(37-2)15-9-21/h7-16,18-19H,3-6,17H2,1-2H3,(H,32,36)(H,33,34,35) |
| InChIKey | HZTDVWJMFZRKMZ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|