C25H26FN3O2S2 — CID 24963142
6-[[(Z)-2-(4-fluorophenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]-N-(1,3-thiazol-2-yl)hexanamide (PubChem CID 24963142) has the molecular formula C25H26FN3O2S2 and a molecular weight of 483.63 g/mol. Its IUPAC name is 6-[[(Z)-2-(4-fluorophenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]-N-(1,3-thiazol-2-yl)hexanamide.
| Compound Name | 6-[[(Z)-2-(4-fluorophenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]-N-(1,3-thiazol-2-yl)hexanamide |
|---|---|
| PubChem CID | 24963142 |
| Molecular Formula | C25H26FN3O2S2 |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 6-[[(Z)-2-(4-fluorophenyl)-3-(4-methylsulfanylphenyl)prop-2-enoyl]amino]-N-(1,3-thiazol-2-yl)hexanamide |
| SMILES | CSc1ccc(/C=C(\C(=O)NCCCCCC(=O)Nc2nccs2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H26FN3O2S2/c1-32-21-12-6-18(7-13-21)17-22(19-8-10-20(26)11-9-19)24(31)27-14-4-2-3-5-23(30)29-25-28-15-16-33-25/h6-13,15-17H,2-5,14H2,1H3,(H,27,31)(H,28,29,30)/b22-17- |
| InChIKey | KTUJLWBEKLPPKQ-XLNRJJMWSA-N |
| XLogP | 5.86 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|