C25H35N3O5S — CID 143455005
ethane;(Z)-N-hexyl-3-(4-methylsulfanylphenyl)-2-(4-nitrophenyl)prop-2-enamide;N-hydroxyformamide (PubChem CID 143455005) has the molecular formula C25H35N3O5S and a molecular weight of 489.64 g/mol. Its IUPAC name is ethane;(Z)-N-hexyl-3-(4-methylsulfanylphenyl)-2-(4-nitrophenyl)prop-2-enamide;N-hydroxyformamide.
| Compound Name | ethane;(Z)-N-hexyl-3-(4-methylsulfanylphenyl)-2-(4-nitrophenyl)prop-2-enamide;N-hydroxyformamide |
|---|---|
| PubChem CID | 143455005 |
| Molecular Formula | C25H35N3O5S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | ethane;(Z)-N-hexyl-3-(4-methylsulfanylphenyl)-2-(4-nitrophenyl)prop-2-enamide;N-hydroxyformamide |
| SMILES | CC.CCCCCCNC(=O)/C(=C\c1ccc(SC)cc1)c1ccc([N+](=O)[O-])cc1.O=CNO |
| InChI | InChI=1S/C22H26N2O3S.C2H6.CH3NO2/c1-3-4-5-6-15-23-22(25)21(16-17-7-13-20(28-2)14-8-17)18-9-11-19(12-10-18)24(26)27;1-2;3-1-2-4/h7-14,16H,3-6,15H2,1-2H3,(H,23,25);1-2H3;1,4H,(H,2,3)/b21-16-;; |
| InChIKey | AYUHOHMYOMLJIL-LDDZECERSA-N |
| XLogP | 5.70 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|