C20H24N2O3S2 — CID 74374714
N-hydroxy-6-[[3-(4-methylsulfanylphenyl)-2-thiophen-2-ylprop-2-enoyl]amino]hexanamide (PubChem CID 74374714) has the molecular formula C20H24N2O3S2 and a molecular weight of 404.56 g/mol. Its IUPAC name is N-hydroxy-6-[[3-(4-methylsulfanylphenyl)-2-thiophen-2-ylprop-2-enoyl]amino]hexanamide.
| Compound Name | N-hydroxy-6-[[3-(4-methylsulfanylphenyl)-2-thiophen-2-ylprop-2-enoyl]amino]hexanamide |
|---|---|
| PubChem CID | 74374714 |
| Molecular Formula | C20H24N2O3S2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-hydroxy-6-[[3-(4-methylsulfanylphenyl)-2-thiophen-2-ylprop-2-enoyl]amino]hexanamide |
| SMILES | CSc1ccc(C=C(C(=O)NCCCCCC(=O)NO)c2cccs2)cc1 |
| InChI | InChI=1S/C20H24N2O3S2/c1-26-16-10-8-15(9-11-16)14-17(18-6-5-13-27-18)20(24)21-12-4-2-3-7-19(23)22-25/h5-6,8-11,13-14,25H,2-4,7,12H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | MZYJYVVNVRUWJE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|