C28H30FN3O4S — CID 74438608
N-(2-aminophenyl)-6-[[2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)prop-2-enoyl]amino]hexanamide (PubChem CID 74438608) has the molecular formula C28H30FN3O4S and a molecular weight of 523.63 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[[2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)prop-2-enoyl]amino]hexanamide.
| Compound Name | N-(2-aminophenyl)-6-[[2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)prop-2-enoyl]amino]hexanamide |
|---|---|
| PubChem CID | 74438608 |
| Molecular Formula | C28H30FN3O4S |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | N-(2-aminophenyl)-6-[[2-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)prop-2-enoyl]amino]hexanamide |
| SMILES | CS(=O)(=O)c1ccc(C=C(C(=O)NCCCCCC(=O)Nc2ccccc2N)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H30FN3O4S/c1-37(35,36)23-16-10-20(11-17-23)19-24(21-12-14-22(29)15-13-21)28(34)31-18-6-2-3-9-27(33)32-26-8-5-4-7-25(26)30/h4-5,7-8,10-17,19H,2-3,6,9,18,30H2,1H3,(H,31,34)(H,32,33) |
| InChIKey | IFGFJVCIDWNZQF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|