C20H21N3O2S — CID 46328836
4-methyl-N-[5-(pentanoylamino)-1,3-benzothiazol-2-yl]benzamide (PubChem CID 46328836) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 4-methyl-N-[5-(pentanoylamino)-1,3-benzothiazol-2-yl]benzamide.
| Compound Name | 4-methyl-N-[5-(pentanoylamino)-1,3-benzothiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 46328836 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 4-methyl-N-[5-(pentanoylamino)-1,3-benzothiazol-2-yl]benzamide |
| SMILES | CCCCC(=O)Nc1ccc2sc(NC(=O)c3ccc(C)cc3)nc2c1 |
| InChI | InChI=1S/C20H21N3O2S/c1-3-4-5-18(24)21-15-10-11-17-16(12-15)22-20(26-17)23-19(25)14-8-6-13(2)7-9-14/h6-12H,3-5H2,1-2H3,(H,21,24)(H,22,23,25) |
| InChIKey | BJHSKMOORCBDJE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |