C19H19N3O2S — CID 46328837
N-[5-(butanoylamino)-1,3-benzothiazol-2-yl]-4-methylbenzamide (PubChem CID 46328837) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is N-[5-(butanoylamino)-1,3-benzothiazol-2-yl]-4-methylbenzamide.
| Compound Name | N-[5-(butanoylamino)-1,3-benzothiazol-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 46328837 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-[5-(butanoylamino)-1,3-benzothiazol-2-yl]-4-methylbenzamide |
| SMILES | CCCC(=O)Nc1ccc2sc(NC(=O)c3ccc(C)cc3)nc2c1 |
| InChI | InChI=1S/C19H19N3O2S/c1-3-4-17(23)20-14-9-10-16-15(11-14)21-19(25-16)22-18(24)13-7-5-12(2)6-8-13/h5-11H,3-4H2,1-2H3,(H,20,23)(H,21,22,24) |
| InChIKey | VOLZHZPEXRXYLM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |