C18H16FN3O2S — CID 46328841
N-[2-(butanoylamino)-1,3-benzothiazol-5-yl]-2-fluorobenzamide (PubChem CID 46328841) has the molecular formula C18H16FN3O2S and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[2-(butanoylamino)-1,3-benzothiazol-5-yl]-2-fluorobenzamide.
| Compound Name | N-[2-(butanoylamino)-1,3-benzothiazol-5-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 46328841 |
| Molecular Formula | C18H16FN3O2S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-[2-(butanoylamino)-1,3-benzothiazol-5-yl]-2-fluorobenzamide |
| SMILES | CCCC(=O)Nc1nc2cc(NC(=O)c3ccccc3F)ccc2s1 |
| InChI | InChI=1S/C18H16FN3O2S/c1-2-5-16(23)22-18-21-14-10-11(8-9-15(14)25-18)20-17(24)12-6-3-4-7-13(12)19/h3-4,6-10H,2,5H2,1H3,(H,20,24)(H,21,22,23) |
| InChIKey | XLVAVFPGXBKYAO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |