C21H23FN4O2 — CID 50752067
N-[2-[5-(butanoylamino)-1-methylbenzimidazol-2-yl]ethyl]-2-fluorobenzamide (PubChem CID 50752067) has the molecular formula C21H23FN4O2 and a molecular weight of 382.44 g/mol. Its IUPAC name is N-[2-[5-(butanoylamino)-1-methylbenzimidazol-2-yl]ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[5-(butanoylamino)-1-methylbenzimidazol-2-yl]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 50752067 |
| Molecular Formula | C21H23FN4O2 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-[2-[5-(butanoylamino)-1-methylbenzimidazol-2-yl]ethyl]-2-fluorobenzamide |
| SMILES | CCCC(=O)Nc1ccc2c(c1)nc(CCNC(=O)c1ccccc1F)n2C |
| InChI | InChI=1S/C21H23FN4O2/c1-3-6-20(27)24-14-9-10-18-17(13-14)25-19(26(18)2)11-12-23-21(28)15-7-4-5-8-16(15)22/h4-5,7-10,13H,3,6,11-12H2,1-2H3,(H,23,28)(H,24,27) |
| InChIKey | ALHRAIJWFQFYOS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |