C22H25FN4O2 — CID 46270387
3-fluoro-N-[2-[1-methyl-5-(3-methylbutanoylamino)benzimidazol-2-yl]ethyl]benzamide (PubChem CID 46270387) has the molecular formula C22H25FN4O2 and a molecular weight of 396.47 g/mol. Its IUPAC name is 3-fluoro-N-[2-[1-methyl-5-(3-methylbutanoylamino)benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 3-fluoro-N-[2-[1-methyl-5-(3-methylbutanoylamino)benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 46270387 |
| Molecular Formula | C22H25FN4O2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 3-fluoro-N-[2-[1-methyl-5-(3-methylbutanoylamino)benzimidazol-2-yl]ethyl]benzamide |
| SMILES | CC(C)CC(=O)Nc1ccc2c(c1)nc(CCNC(=O)c1cccc(F)c1)n2C |
| InChI | InChI=1S/C22H25FN4O2/c1-14(2)11-21(28)25-17-7-8-19-18(13-17)26-20(27(19)3)9-10-24-22(29)15-5-4-6-16(23)12-15/h4-8,12-14H,9-11H2,1-3H3,(H,24,29)(H,25,28) |
| InChIKey | WGAKSSDUEJEPLI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |