C19H22N4O2S — CID 50751833
N-[2-[1-methyl-5-(2-methylpropanoylamino)benzimidazol-2-yl]ethyl]thiophene-2-carboxamide (PubChem CID 50751833) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is N-[2-[1-methyl-5-(2-methylpropanoylamino)benzimidazol-2-yl]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[1-methyl-5-(2-methylpropanoylamino)benzimidazol-2-yl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 50751833 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-[2-[1-methyl-5-(2-methylpropanoylamino)benzimidazol-2-yl]ethyl]thiophene-2-carboxamide |
| SMILES | CC(C)C(=O)Nc1ccc2c(c1)nc(CCNC(=O)c1cccs1)n2C |
| InChI | InChI=1S/C19H22N4O2S/c1-12(2)18(24)21-13-6-7-15-14(11-13)22-17(23(15)3)8-9-20-19(25)16-5-4-10-26-16/h4-7,10-12H,8-9H2,1-3H3,(H,20,25)(H,21,24) |
| InChIKey | FZJQCTIALAYOMI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |