C24H20ClFN4O2 — CID 50751454
N-[2-[5-[(2-chlorobenzoyl)amino]-1-methylbenzimidazol-2-yl]ethyl]-2-fluorobenzamide (PubChem CID 50751454) has the molecular formula C24H20ClFN4O2 and a molecular weight of 450.90 g/mol. Its IUPAC name is N-[2-[5-[(2-chlorobenzoyl)amino]-1-methylbenzimidazol-2-yl]ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[5-[(2-chlorobenzoyl)amino]-1-methylbenzimidazol-2-yl]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 50751454 |
| Molecular Formula | C24H20ClFN4O2 |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | N-[2-[5-[(2-chlorobenzoyl)amino]-1-methylbenzimidazol-2-yl]ethyl]-2-fluorobenzamide |
| SMILES | Cn1c(CCNC(=O)c2ccccc2F)nc2cc(NC(=O)c3ccccc3Cl)ccc21 |
| InChI | InChI=1S/C24H20ClFN4O2/c1-30-21-11-10-15(28-24(32)16-6-2-4-8-18(16)25)14-20(21)29-22(30)12-13-27-23(31)17-7-3-5-9-19(17)26/h2-11,14H,12-13H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | ORHBZKPGHOCGMX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |