C25H25N5O2S — CID 17235984
N-[2-[(4-benzoylpiperazin-1-yl)methyl]-1-methylbenzimidazol-5-yl]thiophene-2-carboxamide (PubChem CID 17235984) has the molecular formula C25H25N5O2S and a molecular weight of 459.58 g/mol. Its IUPAC name is N-[2-[(4-benzoylpiperazin-1-yl)methyl]-1-methylbenzimidazol-5-yl]thiophene-2-carboxamide.
| Compound Name | N-[2-[(4-benzoylpiperazin-1-yl)methyl]-1-methylbenzimidazol-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17235984 |
| Molecular Formula | C25H25N5O2S |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | N-[2-[(4-benzoylpiperazin-1-yl)methyl]-1-methylbenzimidazol-5-yl]thiophene-2-carboxamide |
| SMILES | Cn1c(CN2CCN(C(=O)c3ccccc3)CC2)nc2cc(NC(=O)c3cccs3)ccc21 |
| InChI | InChI=1S/C25H25N5O2S/c1-28-21-10-9-19(26-24(31)22-8-5-15-33-22)16-20(21)27-23(28)17-29-11-13-30(14-12-29)25(32)18-6-3-2-4-7-18/h2-10,15-16H,11-14,17H2,1H3,(H,26,31) |
| InChIKey | AKBOPSYQODBHQK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |