C20H25N5OS — CID 17236134
N-[1-ethyl-2-[(4-methylpiperazin-1-yl)methyl]benzimidazol-5-yl]thiophene-2-carboxamide (PubChem CID 17236134) has the molecular formula C20H25N5OS and a molecular weight of 383.52 g/mol. Its IUPAC name is N-[1-ethyl-2-[(4-methylpiperazin-1-yl)methyl]benzimidazol-5-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-ethyl-2-[(4-methylpiperazin-1-yl)methyl]benzimidazol-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17236134 |
| Molecular Formula | C20H25N5OS |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-[1-ethyl-2-[(4-methylpiperazin-1-yl)methyl]benzimidazol-5-yl]thiophene-2-carboxamide |
| SMILES | CCn1c(CN2CCN(C)CC2)nc2cc(NC(=O)c3cccs3)ccc21 |
| InChI | InChI=1S/C20H25N5OS/c1-3-25-17-7-6-15(21-20(26)18-5-4-12-27-18)13-16(17)22-19(25)14-24-10-8-23(2)9-11-24/h4-7,12-13H,3,8-11,14H2,1-2H3,(H,21,26) |
| InChIKey | WEKHSEIXQSHVHV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |