C21H26N4OS — CID 23612865
N-[2-(azepan-1-ylmethyl)-1-ethylbenzimidazol-5-yl]thiophene-2-carboxamide (PubChem CID 23612865) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is N-[2-(azepan-1-ylmethyl)-1-ethylbenzimidazol-5-yl]thiophene-2-carboxamide.
| Compound Name | N-[2-(azepan-1-ylmethyl)-1-ethylbenzimidazol-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 23612865 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-[2-(azepan-1-ylmethyl)-1-ethylbenzimidazol-5-yl]thiophene-2-carboxamide |
| SMILES | CCn1c(CN2CCCCCC2)nc2cc(NC(=O)c3cccs3)ccc21 |
| InChI | InChI=1S/C21H26N4OS/c1-2-25-18-10-9-16(22-21(26)19-8-7-13-27-19)14-17(18)23-20(25)15-24-11-5-3-4-6-12-24/h7-10,13-14H,2-6,11-12,15H2,1H3,(H,22,26) |
| InChIKey | UPOXFLPGPRRSET-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |