C21H32N4O — CID 23612860
N-[2-(azepan-1-ylmethyl)-1-ethylbenzimidazol-5-yl]pentanamide (PubChem CID 23612860) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is N-[2-(azepan-1-ylmethyl)-1-ethylbenzimidazol-5-yl]pentanamide.
| Compound Name | N-[2-(azepan-1-ylmethyl)-1-ethylbenzimidazol-5-yl]pentanamide |
|---|---|
| PubChem CID | 23612860 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | N-[2-(azepan-1-ylmethyl)-1-ethylbenzimidazol-5-yl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc2c(c1)nc(CN1CCCCCC1)n2CC |
| InChI | InChI=1S/C21H32N4O/c1-3-5-10-21(26)22-17-11-12-19-18(15-17)23-20(25(19)4-2)16-24-13-8-6-7-9-14-24/h11-12,15H,3-10,13-14,16H2,1-2H3,(H,22,26) |
| InChIKey | BNKFMONWRFMHIW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |