C26H34N4O2 — CID 53207619
N-[1-butyl-2-(piperidin-1-ylmethyl)benzimidazol-5-yl]-2-(3-methylphenoxy)acetamide (PubChem CID 53207619) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is N-[1-butyl-2-(piperidin-1-ylmethyl)benzimidazol-5-yl]-2-(3-methylphenoxy)acetamide.
| Compound Name | N-[1-butyl-2-(piperidin-1-ylmethyl)benzimidazol-5-yl]-2-(3-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 53207619 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | N-[1-butyl-2-(piperidin-1-ylmethyl)benzimidazol-5-yl]-2-(3-methylphenoxy)acetamide |
| SMILES | CCCCn1c(CN2CCCCC2)nc2cc(NC(=O)COc3cccc(C)c3)ccc21 |
| InChI | InChI=1S/C26H34N4O2/c1-3-4-15-30-24-12-11-21(27-26(31)19-32-22-10-8-9-20(2)16-22)17-23(24)28-25(30)18-29-13-6-5-7-14-29/h8-12,16-17H,3-7,13-15,18-19H2,1-2H3,(H,27,31) |
| InChIKey | ULRDMPWECPCMFI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |