C28H31N5O2 — CID 23611196
N-[2-[(4-benzylpiperazin-1-yl)methyl]-1-methylbenzimidazol-5-yl]-2-phenoxyacetamide (PubChem CID 23611196) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-[2-[(4-benzylpiperazin-1-yl)methyl]-1-methylbenzimidazol-5-yl]-2-phenoxyacetamide.
| Compound Name | N-[2-[(4-benzylpiperazin-1-yl)methyl]-1-methylbenzimidazol-5-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 23611196 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | N-[2-[(4-benzylpiperazin-1-yl)methyl]-1-methylbenzimidazol-5-yl]-2-phenoxyacetamide |
| SMILES | Cn1c(CN2CCN(Cc3ccccc3)CC2)nc2cc(NC(=O)COc3ccccc3)ccc21 |
| InChI | InChI=1S/C28H31N5O2/c1-31-26-13-12-23(29-28(34)21-35-24-10-6-3-7-11-24)18-25(26)30-27(31)20-33-16-14-32(15-17-33)19-22-8-4-2-5-9-22/h2-13,18H,14-17,19-21H2,1H3,(H,29,34) |
| InChIKey | NHIIHWRPBBLDNM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |