C29H33N5O2 — CID 4888718
N-[2-[2-(4-benzylpiperazin-1-yl)ethyl]-1-methylbenzimidazol-5-yl]-4-methoxybenzamide (PubChem CID 4888718) has the molecular formula C29H33N5O2 and a molecular weight of 483.62 g/mol. Its IUPAC name is N-[2-[2-(4-benzylpiperazin-1-yl)ethyl]-1-methylbenzimidazol-5-yl]-4-methoxybenzamide.
| Compound Name | N-[2-[2-(4-benzylpiperazin-1-yl)ethyl]-1-methylbenzimidazol-5-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 4888718 |
| Molecular Formula | C29H33N5O2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | N-[2-[2-(4-benzylpiperazin-1-yl)ethyl]-1-methylbenzimidazol-5-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3c(c2)nc(CCN2CCN(Cc4ccccc4)CC2)n3C)cc1 |
| InChI | InChI=1S/C29H33N5O2/c1-32-27-13-10-24(30-29(35)23-8-11-25(36-2)12-9-23)20-26(27)31-28(32)14-15-33-16-18-34(19-17-33)21-22-6-4-3-5-7-22/h3-13,20H,14-19,21H2,1-2H3,(H,30,35) |
| InChIKey | GJWAFTBLRHBIEH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |