C29H33N5O — CID 4888721
N-[2-[2-(4-benzylpiperazin-1-yl)ethyl]-1-methylbenzimidazol-5-yl]-4-methylbenzamide (PubChem CID 4888721) has the molecular formula C29H33N5O and a molecular weight of 467.62 g/mol. Its IUPAC name is N-[2-[2-(4-benzylpiperazin-1-yl)ethyl]-1-methylbenzimidazol-5-yl]-4-methylbenzamide.
| Compound Name | N-[2-[2-(4-benzylpiperazin-1-yl)ethyl]-1-methylbenzimidazol-5-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 4888721 |
| Molecular Formula | C29H33N5O |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | N-[2-[2-(4-benzylpiperazin-1-yl)ethyl]-1-methylbenzimidazol-5-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc3c(c2)nc(CCN2CCN(Cc4ccccc4)CC2)n3C)cc1 |
| InChI | InChI=1S/C29H33N5O/c1-22-8-10-24(11-9-22)29(35)30-25-12-13-27-26(20-25)31-28(32(27)2)14-15-33-16-18-34(19-17-33)21-23-6-4-3-5-7-23/h3-13,20H,14-19,21H2,1-2H3,(H,30,35) |
| InChIKey | ZEUQBECFCSKTSX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |