C28H30N6O3 — CID 4895623
N-[1-methyl-2-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]benzimidazol-5-yl]-4-nitrobenzamide (PubChem CID 4895623) has the molecular formula C28H30N6O3 and a molecular weight of 498.59 g/mol. Its IUPAC name is N-[1-methyl-2-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]benzimidazol-5-yl]-4-nitrobenzamide.
| Compound Name | N-[1-methyl-2-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]benzimidazol-5-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 4895623 |
| Molecular Formula | C28H30N6O3 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | N-[1-methyl-2-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]benzimidazol-5-yl]-4-nitrobenzamide |
| SMILES | Cc1ccc(N2CCN(CCc3nc4cc(NC(=O)c5ccc([N+](=O)[O-])cc5)ccc4n3C)CC2)cc1 |
| InChI | InChI=1S/C28H30N6O3/c1-20-3-8-23(9-4-20)33-17-15-32(16-18-33)14-13-27-30-25-19-22(7-12-26(25)31(27)2)29-28(35)21-5-10-24(11-6-21)34(36)37/h3-12,19H,13-18H2,1-2H3,(H,29,35) |
| InChIKey | QQTFFPLSOBVRDZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|