C27H30N6O — CID 4886323
1-[1-methyl-2-[2-(4-phenylpiperazin-1-yl)ethyl]benzimidazol-5-yl]-3-phenylurea (PubChem CID 4886323) has the molecular formula C27H30N6O and a molecular weight of 454.58 g/mol. Its IUPAC name is 1-[1-methyl-2-[2-(4-phenylpiperazin-1-yl)ethyl]benzimidazol-5-yl]-3-phenylurea.
| Compound Name | 1-[1-methyl-2-[2-(4-phenylpiperazin-1-yl)ethyl]benzimidazol-5-yl]-3-phenylurea |
|---|---|
| PubChem CID | 4886323 |
| Molecular Formula | C27H30N6O |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 1-[1-methyl-2-[2-(4-phenylpiperazin-1-yl)ethyl]benzimidazol-5-yl]-3-phenylurea |
| SMILES | Cn1c(CCN2CCN(c3ccccc3)CC2)nc2cc(NC(=O)Nc3ccccc3)ccc21 |
| InChI | InChI=1S/C27H30N6O/c1-31-25-13-12-22(29-27(34)28-21-8-4-2-5-9-21)20-24(25)30-26(31)14-15-32-16-18-33(19-17-32)23-10-6-3-7-11-23/h2-13,20H,14-19H2,1H3,(H2,28,29,34) |
| InChIKey | DENWJCCRESWYHI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |