C26H29N7O — CID 4902774
1-[1-methyl-2-[2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]benzimidazol-5-yl]-3-phenylurea (PubChem CID 4902774) has the molecular formula C26H29N7O and a molecular weight of 455.57 g/mol. Its IUPAC name is 1-[1-methyl-2-[2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]benzimidazol-5-yl]-3-phenylurea.
| Compound Name | 1-[1-methyl-2-[2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]benzimidazol-5-yl]-3-phenylurea |
|---|---|
| PubChem CID | 4902774 |
| Molecular Formula | C26H29N7O |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 1-[1-methyl-2-[2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]benzimidazol-5-yl]-3-phenylurea |
| SMILES | Cn1c(CCN2CCN(c3ccccn3)CC2)nc2cc(NC(=O)Nc3ccccc3)ccc21 |
| InChI | InChI=1S/C26H29N7O/c1-31-23-11-10-21(29-26(34)28-20-7-3-2-4-8-20)19-22(23)30-25(31)12-14-32-15-17-33(18-16-32)24-9-5-6-13-27-24/h2-11,13,19H,12,14-18H2,1H3,(H2,28,29,34) |
| InChIKey | PUDSBEHTWIMNSL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |