C27H27FN6O3 — CID 4895850
N-[2-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1-methylbenzimidazol-5-yl]-3-nitrobenzamide (PubChem CID 4895850) has the molecular formula C27H27FN6O3 and a molecular weight of 502.55 g/mol. Its IUPAC name is N-[2-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1-methylbenzimidazol-5-yl]-3-nitrobenzamide.
| Compound Name | N-[2-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1-methylbenzimidazol-5-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 4895850 |
| Molecular Formula | C27H27FN6O3 |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | N-[2-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1-methylbenzimidazol-5-yl]-3-nitrobenzamide |
| SMILES | Cn1c(CCN2CCN(c3ccc(F)cc3)CC2)nc2cc(NC(=O)c3cccc([N+](=O)[O-])c3)ccc21 |
| InChI | InChI=1S/C27H27FN6O3/c1-31-25-10-7-21(29-27(35)19-3-2-4-23(17-19)34(36)37)18-24(25)30-26(31)11-12-32-13-15-33(16-14-32)22-8-5-20(28)6-9-22/h2-10,17-18H,11-16H2,1H3,(H,29,35) |
| InChIKey | DVLHOTZZKYVEHR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|