C23H29N5O2 — CID 46263374
N-[2-[(4-ethylpiperazin-1-yl)methyl]-1-methylbenzimidazol-5-yl]-4-methoxybenzamide (PubChem CID 46263374) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N-[2-[(4-ethylpiperazin-1-yl)methyl]-1-methylbenzimidazol-5-yl]-4-methoxybenzamide.
| Compound Name | N-[2-[(4-ethylpiperazin-1-yl)methyl]-1-methylbenzimidazol-5-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 46263374 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | N-[2-[(4-ethylpiperazin-1-yl)methyl]-1-methylbenzimidazol-5-yl]-4-methoxybenzamide |
| SMILES | CCN1CCN(Cc2nc3cc(NC(=O)c4ccc(OC)cc4)ccc3n2C)CC1 |
| InChI | InChI=1S/C23H29N5O2/c1-4-27-11-13-28(14-12-27)16-22-25-20-15-18(7-10-21(20)26(22)2)24-23(29)17-5-8-19(30-3)9-6-17/h5-10,15H,4,11-14,16H2,1-3H3,(H,24,29) |
| InChIKey | DJSGEGKDZSAZTC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |