C22H27N4O3+ — CID 7005485
4-methoxy-N-[1-methyl-2-(2-morpholin-4-ium-4-ylethyl)benzimidazol-5-yl]benzamide (PubChem CID 7005485) has the molecular formula C22H27N4O3+ and a molecular weight of 395.48 g/mol. Its IUPAC name is 4-methoxy-N-[1-methyl-2-(2-morpholin-4-ium-4-ylethyl)benzimidazol-5-yl]benzamide.
| Compound Name | 4-methoxy-N-[1-methyl-2-(2-morpholin-4-ium-4-ylethyl)benzimidazol-5-yl]benzamide |
|---|---|
| PubChem CID | 7005485 |
| Molecular Formula | C22H27N4O3+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 4-methoxy-N-[1-methyl-2-(2-morpholin-4-ium-4-ylethyl)benzimidazol-5-yl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3c(c2)nc(CC[NH+]2CCOCC2)n3C)cc1 |
| InChI | InChI=1S/C22H26N4O3/c1-25-20-8-5-17(23-22(27)16-3-6-18(28-2)7-4-16)15-19(20)24-21(25)9-10-26-11-13-29-14-12-26/h3-8,15H,9-14H2,1-2H3,(H,23,27)/p+1 |
| InChIKey | VELYHKSFVKOWOG-UHFFFAOYSA-O |
| XLogP | 1.29 |
| TPSA | 69.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |