C21H21N3O2S2 — CID 9181732
N-[4-[4-(thiophen-3-ylmethyl)piperazine-1-carbonyl]phenyl]thiophene-2-carboxamide (PubChem CID 9181732) has the molecular formula C21H21N3O2S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-[4-[4-(thiophen-3-ylmethyl)piperazine-1-carbonyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[4-(thiophen-3-ylmethyl)piperazine-1-carbonyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9181732 |
| Molecular Formula | C21H21N3O2S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | N-[4-[4-(thiophen-3-ylmethyl)piperazine-1-carbonyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(=O)N2CCN(Cc3ccsc3)CC2)cc1)c1cccs1 |
| InChI | InChI=1S/C21H21N3O2S2/c25-20(19-2-1-12-28-19)22-18-5-3-17(4-6-18)21(26)24-10-8-23(9-11-24)14-16-7-13-27-15-16/h1-7,12-13,15H,8-11,14H2,(H,22,25) |
| InChIKey | XJNPKYPJPFZVMA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |