C21H21ClN2O2S2 — CID 44526136
N-[3-chloro-4-[1-(thiophen-3-ylmethyl)piperidin-4-yl]oxyphenyl]thiophene-2-carboxamide (PubChem CID 44526136) has the molecular formula C21H21ClN2O2S2 and a molecular weight of 433.00 g/mol. Its IUPAC name is N-[3-chloro-4-[1-(thiophen-3-ylmethyl)piperidin-4-yl]oxyphenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-chloro-4-[1-(thiophen-3-ylmethyl)piperidin-4-yl]oxyphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 44526136 |
| Molecular Formula | C21H21ClN2O2S2 |
| Molecular Weight | 433.00 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | N-[3-chloro-4-[1-(thiophen-3-ylmethyl)piperidin-4-yl]oxyphenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(OC2CCN(Cc3ccsc3)CC2)c(Cl)c1)c1cccs1 |
| InChI | InChI=1S/C21H21ClN2O2S2/c22-18-12-16(23-21(25)20-2-1-10-28-20)3-4-19(18)26-17-5-8-24(9-6-17)13-15-7-11-27-14-15/h1-4,7,10-12,14,17H,5-6,8-9,13H2,(H,23,25) |
| InChIKey | ATLSZLQIJIDRIK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.00 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |