C21H27ClN2O2S — CID 44526579
N-[3-chloro-4-[1-(3-methylbutyl)piperidin-4-yl]oxyphenyl]thiophene-2-carboxamide (PubChem CID 44526579) has the molecular formula C21H27ClN2O2S and a molecular weight of 406.98 g/mol. Its IUPAC name is N-[3-chloro-4-[1-(3-methylbutyl)piperidin-4-yl]oxyphenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-chloro-4-[1-(3-methylbutyl)piperidin-4-yl]oxyphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 44526579 |
| Molecular Formula | C21H27ClN2O2S |
| Molecular Weight | 406.98 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[3-chloro-4-[1-(3-methylbutyl)piperidin-4-yl]oxyphenyl]thiophene-2-carboxamide |
| SMILES | CC(C)CCN1CCC(Oc2ccc(NC(=O)c3cccs3)cc2Cl)CC1 |
| InChI | InChI=1S/C21H27ClN2O2S/c1-15(2)7-10-24-11-8-17(9-12-24)26-19-6-5-16(14-18(19)22)23-21(25)20-4-3-13-27-20/h3-6,13-15,17H,7-12H2,1-2H3,(H,23,25) |
| InChIKey | NAWDQWXDFAKNSK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.98 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |