C18H19ClN2O4S — CID 23799051
2-[[2-chloro-4-(thiophene-2-carbonylamino)benzoyl]amino]-4-methylpentanoic acid (PubChem CID 23799051) has the molecular formula C18H19ClN2O4S and a molecular weight of 394.88 g/mol. Its IUPAC name is 2-[[2-chloro-4-(thiophene-2-carbonylamino)benzoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-chloro-4-(thiophene-2-carbonylamino)benzoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 23799051 |
| Molecular Formula | C18H19ClN2O4S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2-[[2-chloro-4-(thiophene-2-carbonylamino)benzoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)c1ccc(NC(=O)c2cccs2)cc1Cl)C(=O)O |
| InChI | InChI=1S/C18H19ClN2O4S/c1-10(2)8-14(18(24)25)21-16(22)12-6-5-11(9-13(12)19)20-17(23)15-4-3-7-26-15/h3-7,9-10,14H,8H2,1-2H3,(H,20,23)(H,21,22)(H,24,25) |
| InChIKey | NVBJQOKHQPBYNC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |