C23H22ClFN2O2S — CID 44526994
N-[3-chloro-4-[1-(thiophen-3-ylmethyl)piperidin-4-yl]oxyphenyl]-4-fluorobenzamide (PubChem CID 44526994) has the molecular formula C23H22ClFN2O2S and a molecular weight of 444.96 g/mol. Its IUPAC name is N-[3-chloro-4-[1-(thiophen-3-ylmethyl)piperidin-4-yl]oxyphenyl]-4-fluorobenzamide.
| Compound Name | N-[3-chloro-4-[1-(thiophen-3-ylmethyl)piperidin-4-yl]oxyphenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 44526994 |
| Molecular Formula | C23H22ClFN2O2S |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N-[3-chloro-4-[1-(thiophen-3-ylmethyl)piperidin-4-yl]oxyphenyl]-4-fluorobenzamide |
| SMILES | O=C(Nc1ccc(OC2CCN(Cc3ccsc3)CC2)c(Cl)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H22ClFN2O2S/c24-21-13-19(26-23(28)17-1-3-18(25)4-2-17)5-6-22(21)29-20-7-10-27(11-8-20)14-16-9-12-30-15-16/h1-6,9,12-13,15,20H,7-8,10-11,14H2,(H,26,28) |
| InChIKey | VSPTVTGGLUMBSV-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |