C22H20ClN3O3S — CID 71907660
3-(3-chlorophenoxy)-N-[3-(thiophene-2-carbonylamino)phenyl]pyrrolidine-1-carboxamide (PubChem CID 71907660) has the molecular formula C22H20ClN3O3S and a molecular weight of 441.94 g/mol. Its IUPAC name is 3-(3-chlorophenoxy)-N-[3-(thiophene-2-carbonylamino)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | 3-(3-chlorophenoxy)-N-[3-(thiophene-2-carbonylamino)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 71907660 |
| Molecular Formula | C22H20ClN3O3S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 3-(3-chlorophenoxy)-N-[3-(thiophene-2-carbonylamino)phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)N2CCC(Oc3cccc(Cl)c3)C2)c1)c1cccs1 |
| InChI | InChI=1S/C22H20ClN3O3S/c23-15-4-1-7-18(12-15)29-19-9-10-26(14-19)22(28)25-17-6-2-5-16(13-17)24-21(27)20-8-3-11-30-20/h1-8,11-13,19H,9-10,14H2,(H,24,27)(H,25,28) |
| InChIKey | JEXZKHFEBVTCHI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |