C14H14ClN3O2S — CID 121150643
N-(3-chlorophenyl)-3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carboxamide (PubChem CID 121150643) has the molecular formula C14H14ClN3O2S and a molecular weight of 323.81 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 121150643 |
| Molecular Formula | C14H14ClN3O2S |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | N-(3-chlorophenyl)-3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)N1CCC(Oc2nccs2)C1 |
| InChI | InChI=1S/C14H14ClN3O2S/c15-10-2-1-3-11(8-10)17-13(19)18-6-4-12(9-18)20-14-16-5-7-21-14/h1-3,5,7-8,12H,4,6,9H2,(H,17,19) |
| InChIKey | QEFCIJLMWDVDHX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |